RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0258 |
| Common Name | Hypoxanthine |
| Synonyms Names | Purine-6-ol |
| Formula | C5H4N4O |
| Formula at pH 7.2 (Predicted) | C5H4N4O |
| Molecular Weight | 136.112 |
| Structure |  |
| SMILES | c12(c(nc[nH]1)c(=O)[nH]cn2) |
| Reactions | OSR0082 OSR0114 OSR0145 OSR0489 OSR0571 OSR0601 OSR0777 OSR1594 |
| Pathways | |
|---|---|
| KEGG | rn00230 rn01100 |
| Metacyc | PWY-5043 P121-PWY |
| Database Links | |
|---|---|
| KEGG | C00262 |
| ChEBI | 17368 |