RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0264 |
| Common Name | 2,3,5-Trichlorodienelactone |
| Formula | C6HCl3O4 |
| Formula at pH 7.2 (Predicted) | C6Cl3O4- |
| Molecular Weight | 243.429 |
| Structure |  |
| SMILES | OC(=O)C(=C1OC(=O)C(=C1Cl)Cl)Cl |
| Reactions | OSR0111 |
| Pathways | |
|---|---|
| KEGG | rn00361 rn01120 |
| Database Links | |
|---|---|
| KEGG | C18242 |
| Pubchem Compound | 14951695 |
| Pubchem Substance | 103061424 |