RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0295 |
| Common Name | Orotate |
| Synonyms Names | Orotic acid ;Uracil-6-carboxylic acid |
| Formula | C5H4N2O4 |
| Formula at pH 7.2 (Predicted) | C5H3N2O4- |
| Molecular Weight | 156.096 |
| Structure |  |
| SMILES | C(O)(=O)c1([nH]c(=O)[nH]c(c1)=O) |
| Reactions | OSR0127 OSR0134 OSR0400 OSR0786 |
| Pathways | |
|---|---|
| KEGG | rn00240 rn01100 |
| Metacyc | PWY0-162 |
| Database Links | |
|---|---|
| KEGG | C00295 |
| ChEBI | 16742 |