RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0342 |
| Common Name | Guanine |
| Synonyms Names | 2-Amino-6-hydroxypurine |
| Formula | C5H5N5O |
| Formula at pH 7.2 (Predicted) | C5H5N5O |
| Molecular Weight | 151.126 |
| Structure |  |
| SMILES | c12([nH]cnc(c(=O)[nH]c(N)n1)2) |
| Reactions | OSR0143 OSR0542 OSR0654 OSR0819 OSR2231 |
| Pathways | |
|---|---|
| KEGG | rn00230 rn01100 |
| Metacyc | P1-PWY PWY-5043 P121-PWY |
| Database Links | |
|---|---|
| KEGG | C00242 |
| ChEBI | 16235 |