RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0347 |
| Common Name | 4-Nitrocatechol |
| Formula | C6H5NO4 |
| Formula at pH 7.2 (Predicted) | C6H4NO4- |
| Molecular Weight | 155.108 |
| Structure |  |
| SMILES | [O-][N+](=O)c1ccc(c(c1)O)O |
| Reactions | OSR0176 |
| Pathways | |
|---|---|
| KEGG | rn00627 rn01120 |
| Database Links | |
|---|---|
| KEGG | C02235 |
| ChEBI | 16318 |
| Pubchem Compound | 3505109 |
| Pubchem Substance | 5299 |