RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0354 |
| Common Name | 6-Thiourate |
| Synonyms Names | 6-Thiouric acid |
| Formula | C5H4N4O2S |
| Formula at pH 7.2 (Predicted) | C5H4N4O2S |
| Molecular Weight | 184.176 |
| Structure |  |
| SMILES | O=c1[nH]c2c([nH]1)[nH]c(=O)[nH]c2=S |
| Reactions | OSR0151 |
| Pathways | |
|---|---|
| KEGG | rn00983 |
| Database Links | |
|---|---|
| KEGG | C16613 |
| Pubchem Compound | 3032417 |
| Pubchem Substance | 51090939 |