RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0379 |
| Common Name | (S)(+)-Allantoin |
| Synonyms Names | (S)-Allantoin |
| Formula | C4H6N4O3 |
| Formula at pH 7.2 (Predicted) | C4H5N4O3- |
| Molecular Weight | 158.115 |
| Structure |  |
| SMILES | C1(NC(N)=O)(C(=O)NC(N1)=O) |
| Reactions | OSR0158 OSR0173 OSR0198 |
| Pathways | |
|---|---|
| KEGG | rn00230 rn01100 rn01120 |
| Metacyc | PWY-5044 |
| Database Links | |
|---|---|
| KEGG | C02350 |
| ChEBI | 15678 |
| Pubchem Compound | 439714 |
| Pubchem Substance | 5397 |