RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0385 |
| Common Name | 5-Hydroxyisourate |
| Formula | C5H4N4O4 |
| Formula at pH 7.2 (Predicted) | C5H4N4O4 |
| Molecular Weight | 184.11 |
| Structure |  |
| SMILES | C12=NC(=O)NC1(C(=O)NC(=O)N2)O |
| Reactions | OSR0181 OSR1205 |
| Pathways | |
|---|---|
| KEGG | rn00230 rn01100 rn01120 |
| Metacyc | URSIN-PWY |
| Database Links | |
|---|---|
| KEGG | C11821 |
| ChEBI | 18072 |
| Pubchem Compound | 250388 |
| Pubchem Substance | 13985 |