RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0386 |
| Common Name | (S)-Dihydroorotate |
| Synonyms Names | (S)-4,5-Dihydroorotate ;L-Dihydroorotate ;L-Dihydroorotic acid ;Dihydro-L-orotic acid |
| Formula | C5H6N2O4 |
| Formula at pH 7.2 (Predicted) | C5H5N2O4- |
| Molecular Weight | 158.112 |
| Structure |  |
| SMILES | C1(=O)(CC(C(O)=O)NC(N1)=O) |
| Reactions | OSR0127 OSR0134 OSR0171 OSR0400 |
| Pathways | |
|---|---|
| KEGG | rn00240 rn01100 |
| Metacyc | PWY0-162 |
| Database Links | |
|---|---|
| KEGG | C00337 |
| ChEBI | 17025 |