RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0393 |
| Common Name | 2-Chloromaleylacetate |
| Formula | C6H5ClO5 |
| Formula at pH 7.2 (Predicted) | C6H3ClO52- |
| Molecular Weight | 192.554 |
| Structure |  |
| SMILES | OC(=O)CC(=O)C=C(C(=O)O)Cl |
| Reactions | OSR0091 |
| Pathways | |
|---|---|
| KEGG | rn00361 rn01100 rn01120 |
| Database Links | |
|---|---|
| KEGG | C06329 |
| Pubchem Compound | 9776838 |
| Pubchem Substance | 8565 |