RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0395 |
| Common Name | 3-Chloro-2-methyldienelactone |
| Formula | C7H5ClO4 |
| Formula at pH 7.2 (Predicted) | C7H4ClO4- |
| Molecular Weight | 188.565 |
| Structure |  |
| SMILES | OC(=O)C=C1OC(=O)C(=C1Cl)C |
| Reactions | OSR0157 |
| Pathways | |
|---|---|
| KEGG | rn00623 rn01120 |
| Database Links | |
|---|---|
| KEGG | C18309 |
| Pubchem Compound | 49787040 |
| Pubchem Substance | 103061491 |