RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0398 |
| Common Name | Quinolinate |
| Synonyms Names | Pyridine-2,3-dicarboxylate ;Quinolinic acid ;2,3-Pyridinedicarboxylic acid |
| Formula | C7H5NO4 |
| Formula at pH 7.2 (Predicted) | C7H3NO42- |
| Molecular Weight | 167.119 |
| Structure |  |
| SMILES | C(O)(=O)c1(c(C(=O)O)cccn1) |
| Reactions | OSR0409 OSR0876 |
| Pathways | |
|---|---|
| KEGG | rn00760 rn01100 |
| Metacyc | PYRIDNUCSYN-PWY |
| Database Links | |
|---|---|
| KEGG | C03722 |
| ChEBI | 16675 |