RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0408 |
| Common Name | [Enzyme]-cysteine |
| Synonyms Names | Thiamine biosynthesis intermediate 2 ;C15811 |
| Formula | C4H6N2O2SR2 |
| Formula at pH 7.2 (Predicted) | C4H6O2N2S1R2 |
| Structure |  |
| SMILES | N(C(=O)C(CS)NC(=O)[R])[R] |
| Reactions | OSR0433 |
| Pathways | |
|---|---|
| KEGG | rn00730 |
| Database Links | |
|---|---|
| KEGG | C15811 |
| Pubchem Substance | 47205136 |