RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0416 |
| Common Name | Dehydroascorbate |
| Synonyms Names | Dehydroascorbic acid ;L-Dehydroascorbate ;L-Dehydroascorbic acid |
| Formula | C6H6O6 |
| Formula at pH 7.2 (Predicted) | C6H5O6- |
| Molecular Weight | 174.108 |
| Structure |  |
| SMILES | C1(OC(C(O)CO)C(=O)C(=O)1)(=O) |
| Reactions | OSR0205 OSR0375 OSR0691 OSR1238 OSR1258 OSR1483 OSR2256 OSR2269 OSR2385 |
| Pathways | |
|---|---|
| KEGG | rn00053 rn00480 rn01100 rn00270 rn01110 rn00906 |
| Metacyc | PWY-2261 PWY-6370 ETHYL-PWY PWY-1141 CAROTENOID-PWY |
| Database Links | |
|---|---|
| KEGG | C05422 |
| ChEBI | 27956 |
| Pubchem Compound | 440667 |
| Pubchem Substance | 7786 |