RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0417 |
| Common Name | cis-Aconitate |
| Synonyms Names | cis-Aconitic acid |
| Formula | C6H6O6 |
| Formula at pH 7.2 (Predicted) | C6H3O63- |
| Molecular Weight | 174.108 |
| Structure |  |
| SMILES | C(=O)(O)CC(C(=O)O)=CC(O)=O |
| Reactions | OSR0189 OSR0195 |
| Pathways | |
|---|---|
| KEGG | rn00020 rn00630 rn00720 rn01100 rn01110 rn01120 rn01210 |
| Metacyc | TCA ANARESP1-PWY P23-PWY P105-PWY |
| Database Links | |
|---|---|
| KEGG | C00417 |
| ChEBI | 32805 |