RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0465 |
| Common Name | Oxalosuccinate |
| Synonyms Names | Oxalosuccinic acid |
| Formula | C6H6O7 |
| Formula at pH 7.2 (Predicted) | C6H3O73- |
| Molecular Weight | 190.108 |
| Structure |  |
| SMILES | OC(=O)CC(C(=O)C(=O)O)C(=O)O |
| Reactions | OSR0140 OSR1798 OSR1838 |
| Pathways | |
|---|---|
| KEGG | rn00020 rn01100 rn01110 rn01120 rn01210 |
| Database Links | |
|---|---|
| KEGG | C05379 |
| ChEBI | 7815 |
| Pubchem Compound | 972 |
| Pubchem Substance | 7753 |