RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0492 |
| Common Name | 1-Methyluric acid |
| Formula | C6H6N4O3 |
| Formula at pH 7.2 (Predicted) | C6H6N4O3 |
| Molecular Weight | 182.137 |
| Structure |  |
| SMILES | O=c1[nH]c2c([nH]1)c(=O)n(c(=O)[nH]2)C |
| Reactions | OSR0233 |
| Pathways | |
|---|---|
| KEGG | rn00232 |
| Database Links | |
|---|---|
| KEGG | C16359 |
| Pubchem Compound | 69726 |
| Pubchem Substance | 47205667 |