RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0496 |
| Common Name | L-2,3-Dihydrodipicolinate |
| Synonyms Names | Dihydrodipicolinic acid ;Dihydrodipicolinate ;2,3-Dihydrodipicolinate ;(S)-2,3-Dihydropyridine-2,6-dicarboxylate |
| Formula | C7H7NO4 |
| Formula at pH 7.2 (Predicted) | C7H5NO42- |
| Molecular Weight | 169.135 |
| Structure |  |
| SMILES | C(=O)(O)C1(=NC(C(O)=O)CC=C1) |
| Reactions | OSR0253 OSR1645 OSR1701 OSR2577 |
| Pathways | |
|---|---|
| KEGG | rn00300 rn01100 rn01110 rn01120 |
| Metacyc | DAPLYSINESYN-PWY PWY-5097 PWY-2941 |
| Database Links | |
|---|---|
| KEGG | C03340 |
| ChEBI | 18042 |