RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0505 |
| Common Name | 3-Indoleacetonitrile |
| Synonyms Names | Indol-3-ylacetonitrile ;Indole-3-acetonitrile ;(Indol-3-yl)acetonitrile |
| Formula | C10H8N2 |
| Formula at pH 7.2 (Predicted) | C10H8N2 |
| Molecular Weight | 156.184 |
| Structure |  |
| SMILES | c1(c(CC#N)c2(c([nH]1)cccc2)) |
| Reactions | OSR0230 OSR0243 OSR0284 |
| Pathways | |
|---|---|
| KEGG | rn00380 |
| Database Links | |
|---|---|
| KEGG | C02938 |
| ChEBI | 17566 |
| Pubchem Compound | 351795 |
| Pubchem Substance | 5857 |