RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0508 |
| Common Name | 1-Naphthaldehyde |
| Synonyms Names | 1-Formylnaphthalene |
| Formula | C11H8O |
| Formula at pH 7.2 (Predicted) | C11H8O |
| Molecular Weight | 156.181 |
| Structure |  |
| SMILES | C(=O)c1(c2(c(ccc1)cccc2)) |
| Reactions | OSR0303 OSR1732 |
| Pathways | |
|---|---|
| KEGG | rn00626 rn01120 |
| Database Links | |
|---|---|
| Gramene | CPD-7614 |
| KEGG | C14090 |
| ChEBI | 52367 |
| Pubchem Compound | 6195 |
| Pubchem Substance | 854326 |