RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0526 |
| Common Name | Homogentisate |
| Synonyms Names | Homogentisic acid ;2,5-Dihydroxyphenylacetic acid ;2,5-Dihydroxyphenylacetate |
| Formula | C8H8O4 |
| Formula at pH 7.2 (Predicted) | C8H7O4- |
| Molecular Weight | 168.147 |
| Structure |  |
| SMILES | C(O)(=O)Cc1(c(O)ccc(O)c1) |
| Reactions | OSR0246 OSR1223 OSR1665 OSR2608 OSR2614 |
| Pathways | |
|---|---|
| KEGG | rn00130 rn00350 rn01100 rn00643 rn01120 rn01110 |
| Metacyc | PWY-1581 PWY-1422 TYRFUMCAT-PWY |
| Database Links | |
|---|---|
| KEGG | C00544 |
| ChEBI | 44747 |
| Pubchem Compound | 780 |
| Pubchem Substance | 3825 |