RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0535 |
| Common Name | Allantoate |
| Synonyms Names | Allantoic acid |
| Formula | C4H8N4O4 |
| Formula at pH 7.2 (Predicted) | C4H7N4O4- |
| Molecular Weight | 176.131 |
| Structure |  |
| SMILES | C(C(O)=O)(NC(N)=O)NC(N)=O |
| Reactions | OSR0173 OSR0239 OSR0244 |
| Pathways | |
|---|---|
| KEGG | rn00230 rn01100 rn01120 |
| Database Links | |
|---|---|
| KEGG | C00499 |
| ChEBI | 30837 |