RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0539 |
| Common Name | 5-Hydroxy-2-oxo-4-ureido-2,5-dihydro-1H-imidazole-5-carboxylate |
| Synonyms Names | 5-hydroxy-2-oxo-4-ureido-2,5-dihydro-1H imidazole-5-carboxylate |
| Formula | C5H6N4O5 |
| Formula at pH 7.2 (Predicted) | C5H5N4O5- |
| Molecular Weight | 202.125 |
| Structure |  |
| SMILES | C1(C(O)(C([O-1])=O)[NH]C(=O)N=1)(NC(N)=O) |
| Reactions | OSR0158 OSR0181 |
| Pathways | |
|---|---|
| KEGG | rn00230 rn01100 rn01120 |
| Database Links | |
|---|---|
| Gramene | CPD-5821 |
| KEGG | C12248 |
| ChEBI | 31132 |
| Pubchem Compound | 443736 |
| Pubchem Substance | 14393 |