RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0540 |
| Common Name | N-Carbamoyl-L-aspartate |
| Formula | C5H8N2O5 |
| Formula at pH 7.2 (Predicted) | C5H6N2O52- |
| Molecular Weight | 176.127 |
| Structure |  |
| SMILES | C(=O)(O)CC(C(O)=O)NC(N)=O |
| Reactions | OSR0171 OSR0359 |
| Pathways | |
|---|---|
| KEGG | rn00240 rn01100 rn00250 |
| Metacyc | PWY0-162 |
| Database Links | |
|---|---|
| KEGG | C00438 |
| ChEBI | 15859 |