RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0546 |
| Common Name | triacylglycerol |
| Synonyms Names | Triglyceride ;C00422 |
| Formula | C6H5O6R3 |
| Formula at pH 7.2 (Predicted) | C6H5O6R3 |
| Structure |  |
| SMILES | O=C(OCC(COC(=O)[R])OC(=O)[R])[R] |
| Reactions | OSR0286 OSR0653 OSR1983 |
| Pathways | |
|---|---|
| KEGG | rn00561 rn01100 |
| Database Links | |
|---|---|
| KEGG | C00422 |
| Pubchem Substance | 3712 |