RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0556 |
| Common Name | Protein-L-Asparagine |
| Synonyms Names | Protein asparagine ;Protein L-asparagine ;C03021 |
| Formula | C5H7N3O3R2 |
| Formula at pH 7.2 (Predicted) | C5H7O3N3R2- |
| Structure |  |
| SMILES | N(C(=O)C(CC(N)=O)NC(=O)[R])[R] |
| Reactions | OSR2988 OSR3043 |
| Pathways | |
|---|---|
| KEGG | rn00510 rn00513 rn01100 |
| Database Links | |
|---|---|
| KEGG | C03021 |
| Pubchem Substance | 5927 |