RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0566 |
| Common Name | Citrate |
| Synonyms Names | Citric acid ;2-Hydroxy-1,2,3-propanetricarboxylic acid ;2-Hydroxytricarballylic acid |
| Formula | C6H8O7 |
| Formula at pH 7.2 (Predicted) | C6H5O73- |
| Molecular Weight | 192.124 |
| Structure |  |
| SMILES | C(=O)(O)CC(C(O)=O)(O)CC(O)=O |
| Reactions | OSR0188 OSR0195 OSR0199 OSR2001 OSR2637 |
| Pathways | |
|---|---|
| KEGG | rn00020 rn00630 rn00720 rn01100 rn01110 rn01120 rn01210 |
| Metacyc | TCA ANARESP1-PWY P23-PWY P105-PWY |
| Database Links | |
|---|---|
| KEGG | C00158 |
| ChEBI | 30769 |