RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0571 |
| Common Name | Caffeate |
| Synonyms Names | Caffeic acid ;3,4-Dihydroxy-trans-cinnamate ;trans-Caffeate |
| Formula | C9H8O4 |
| Formula at pH 7.2 (Predicted) | C9H7O4- |
| Molecular Weight | 180.157 |
| Structure |  |
| SMILES | C(O)(=O)C=Cc1(cc(O)c(O)cc1) |
| Reactions | OSR0183 OSR1178 OSR1904 OSR2638 |
| Pathways | |
|---|---|
| KEGG | rn00940 rn01100 rn01110 |
| Metacyc | PWY-1121 |
| Database Links | |
|---|---|
| KEGG | C01197 |
| ChEBI | 16433 |
| Pubchem Compound | 689043 |
| Pubchem Substance | 4422 |