RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0572 |
| Common Name | 3-(4-Hydroxyphenyl)pyruvate |
| Synonyms Names | 4-Hydroxyphenylpyruvate ;p-Hydroxyphenylpyruvic acid |
| Formula | C9H8O4 |
| Formula at pH 7.2 (Predicted) | C9H7O4- |
| Molecular Weight | 180.157 |
| Structure |  |
| SMILES | C(=O)(O)C(=O)Cc1(ccc(O)cc1) |
| Reactions | OSR0246 OSR0627 OSR1949 |
| Pathways | |
|---|---|
| KEGG | rn00130 rn00350 rn01100 rn00400 rn00401 rn00950 rn01110 |
| Metacyc | PWY-1581 PWY-1422 TYRFUMCAT-PWY |
| Database Links | |
|---|---|
| KEGG | C01179 |
| ChEBI | 15999 |