RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0575 |
| Common Name | 1-Nitronaphthalene-5,6-oxide |
| Formula | C10H7NO3 |
| Formula at pH 7.2 (Predicted) | C10H7NO3 |
| Molecular Weight | 189.167 |
| Structure |  |
| SMILES | [O-][N+](=O)c1cccc2c1C=CC1C2O1 |
| Reactions | OSR0980 OSR0981 |
| Pathways | |
|---|---|
| KEGG | rn00980 |
| Database Links | |
|---|---|
| KEGG | C14800 |
| Pubchem Compound | 11954051 |
| Pubchem Substance | 17395798 |