RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0576 |
| Common Name | Indole-3-acetaldehyde |
| Synonyms Names | 2-(Indol-3-yl)acetaldehyde ;Indoleacetaldehyde |
| Formula | C10H9NO |
| Formula at pH 7.2 (Predicted) | C10H9NO |
| Molecular Weight | 159.185 |
| Structure |  |
| SMILES | c1(c(CC=O)c2(c([nH]1)cccc2)) |
| Reactions | OSR0225 OSR0276 OSR0334 OSR0371 OSR0382 OSR1769 OSR1867 OSR1911 |
| Pathways | |
|---|---|
| KEGG | rn00380 rn01100 |
| Metacyc | PWY-3162 |
| Database Links | |
|---|---|
| KEGG | C00637 |
| ChEBI | 18086 |