RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0587 |
| Common Name | Theobromine |
| Synonyms Names | 3,7-Dimethylxanthine |
| Formula | C7H8N4O2 |
| Formula at pH 7.2 (Predicted) | C7H8N4O2 |
| Molecular Weight | 180.164 |
| Structure |  |
| SMILES | Cn1cnc2c1c(=O)[nH]c(=O)n2C |
| Reactions | OSR0319 |
| Pathways | |
|---|---|
| KEGG | rn00232 |
| Database Links | |
|---|---|
| KEGG | C07480 |
| ChEBI | 28946 |
| Pubchem Compound | 5429 |
| Pubchem Substance | 9683 |