RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0598 |
| Common Name | 4-Phospho-L-aspartate |
| Synonyms Names | L-4-Aspartyl phosphate |
| Formula | C4H8NO7P |
| Formula at pH 7.2 (Predicted) | C4H6NO7P2- |
| Molecular Weight | 213.083 |
| Structure |  |
| SMILES | C(=O)(OP(=O)(O)O)CC(N)C(O)=O |
| Reactions | OSR1880 OSR2176 |
| Pathways | |
|---|---|
| KEGG | rn00260 rn00270 rn00300 rn01100 rn01110 rn01120 rn01210 |
| Metacyc | DAPLYSINESYN-PWY PWY-5097 PWY-2941 HOMOSERSYN-PWY P101-PWY PWY-2942 PWY-6562 PWY-6559 |
| Database Links | |
|---|---|
| KEGG | C03082 |
| ChEBI | 15836 |