RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0599 |
| Common Name | Lysophosphatidate |
| Synonyms Names | 2-Lysophosphatidate ;lysophosphatidic acid ;1-Acyl-sn-glycerol 3-phosphate ;C00681 ;ACYL-SN-GLYCEROL-3P |
| Formula | C4H8O7PR |
| Formula at pH 7.2 (Predicted) | C4H6O7P1R1- |
| Structure |  |
| SMILES | OC(COC(=O)[R])CO[P](O)(O)=O |
| Reactions | OSR0323 OSR0358 OSR1998 OSR2035 |
| Pathways | |
|---|---|
| KEGG | rn00561 rn00564 rn01100 |
| Metacyc | PHOSLIPSYN-PWY |
| Database Links | |
|---|---|
| KEGG | C00681 |
| Pubchem Substance | 3950 |