RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0604 |
| Common Name | (5-L-glutamyl)-L-peptide |
| Synonyms Names | (5-L-Glutamyl)-peptide ;C03193 |
| Formula | C5H9N2O3; C7H11N2O5R(C2H2NOR)n |
| Formula at pH 7.2 (Predicted) | C5H6O3N2R1 |
| Structure |  |
| SMILES | C([N+])(CCC(=O)N[Protein])C([O-])=O ; NC(CCC(=O)NC(C(=O)NC(C(O)=O)[R])[R])C(O)=O |
| Reactions | OSR0645 OSR0700 OSR1373 |
| Pathways | |
|---|---|
| KEGG | rn00430 |
| Database Links | |
|---|---|
| KEGG | C03193 |
| Pubchem Substance | 6070 |