RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0615 |
| Common Name | L-Galactono-1,4-lactone |
| Formula | C6H10O6 |
| Formula at pH 7.2 (Predicted) | C6H10O6 |
| Molecular Weight | 178.14 |
| Structure |  |
| SMILES | C1(OC(C(O)CO)C(O)C(O)1)(=O) |
| Reactions | OSR1762 OSR1772 OSR2346 OSR2409 |
| Pathways | |
|---|---|
| KEGG | rn00053 rn01100 rn01110 |
| Metacyc | PWY-882 |
| Database Links | |
|---|---|
| Gramene | CPD-330 |
| KEGG | C01115 |
| ChEBI | 17464 |