RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0621 |
| Common Name | (2S)-2-Isopropyl-3-oxosuccinate |
| Synonyms Names | 3-Carboxy-4-methyl-2-oxopentanoate ;2-Oxo-4-methyl-3-carboxypentanoate |
| Formula | C7H10O5 |
| Formula at pH 7.2 (Predicted) | C7H8O52- |
| Molecular Weight | 174.151 |
| Structure |  |
| SMILES | C(=O)(O)C(C(C)C)C(=O)C(O)=O |
| Reactions | OSR0214 OSR1781 |
| Pathways | |
|---|---|
| KEGG | rn00290 rn01100 rn01110 rn01210 |
| Metacyc | LEUSYN-PWY |
| Database Links | |
|---|---|
| Gramene | CPD-7100 |
| KEGG | C04236 |
| ChEBI | 1467 |
| Pubchem Compound | 5462259 |
| Pubchem Substance | 6905 |