RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0622 |
| Common Name | Shikimate |
| Synonyms Names | Shikimic acid ;3,4,5-Trihydroxy-1-cyclohexenecarboxylic acid |
| Formula | C7H10O5 |
| Formula at pH 7.2 (Predicted) | C7H9O5- |
| Molecular Weight | 174.151 |
| Structure |  |
| SMILES | C(=O)(O)C1(=[CH][CH](O)[CH](O)[CH](O)[CH2]1) |
| Reactions | OSR1149 OSR1856 OSR2299 OSR2313 |
| Pathways | |
|---|---|
| KEGG | rn00400 rn01100 rn01110 rn00940 rn00941 rn00945 |
| Metacyc | ARO-PWY |
| Database Links | |
|---|---|
| KEGG | C00493 |
| ChEBI | 16119 |