RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0625 |
| Common Name | 4-Fumarylacetoacetate |
| Synonyms Names | 4-Fumarylacetoacetic acid ;Fumarylacetoacetate |
| Formula | C8H8O6 |
| Formula at pH 7.2 (Predicted) | C8H6O62- |
| Molecular Weight | 200.145 |
| Structure |  |
| SMILES | C(=O)(O)C=CC(=O)CC(=O)CC(O)=O |
| Reactions | OSR0210 OSR0292 |
| Pathways | |
|---|---|
| KEGG | rn00350 rn00643 rn01100 rn01120 |
| Database Links | |
|---|---|
| KEGG | C01061 |
| ChEBI | 30907 |
| Pubchem Compound | 5280398 |
| Pubchem Substance | 4300 |