RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0628 |
| Common Name | Xanthurenic acid |
| Synonyms Names | Xanthurenate |
| Formula | C10H7NO4 |
| Formula at pH 7.2 (Predicted) | C10H6NO4- |
| Molecular Weight | 205.167 |
| Structure |  |
| SMILES | OC(=O)C1=NC2=C(C=CC=C2O)C(=C1)O |
| Reactions | OSR0251 |
| Pathways | |
|---|---|
| KEGG | rn00380 |
| Database Links | |
|---|---|
| KEGG | C02470 |
| Pubchem Compound | 5699 |
| Pubchem Substance | 5485 |