RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0631 |
| Common Name | Indole-3-acetate |
| Synonyms Names | Indole-3-acetic acid ;(Indol-3-yl)acetate ;Indoleacetate ;Indoleacetic acid ;IAA |
| Formula | C10H9NO2 |
| Formula at pH 7.2 (Predicted) | C10H8NO2- |
| Molecular Weight | 175.184 |
| Structure |  |
| SMILES | c1(c(CC(=O)O)c2(c([nH]1)cccc2)) |
| Reactions | OSR0228 OSR0250 OSR0284 OSR0312 OSR0334 OSR0508 OSR0565 OSR0649 OSR0666 OSR0688 OSR1212 OSR1448 OSR1769 OSR1911 OSR2119 |
| Pathways | |
|---|---|
| KEGG | rn00380 rn01100 |
| Metacyc | PWY-3161 PWY-5025 PWY-1741 PWY-1782 PWY-3162 |
| Database Links | |
|---|---|
| KEGG | C00954 |
| ChEBI | 16411 |