RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0641 |
| Common Name | 3,7-Dimethyluric acid |
| Formula | C7H8N4O3 |
| Formula at pH 7.2 (Predicted) | C7H8N4O3 |
| Molecular Weight | 196.163 |
| Structure |  |
| SMILES | O=c1[nH]c(=O)c2c(n1C)[nH]c(=O)n2C |
| Reactions | OSR0319 |
| Pathways | |
|---|---|
| KEGG | rn00232 |
| Database Links | |
|---|---|
| KEGG | C16360 |
| Pubchem Compound | 83126 |
| Pubchem Substance | 47205668 |