RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0657 |
| Common Name | 1,2-Dihydroxy-8-carboxynaphthalene |
| Synonyms Names | 7,8-Dihydroxy-1-naphthalenecarboxylic acid |
| Formula | C11H8O4 |
| Formula at pH 7.2 (Predicted) | C11H7O4- |
| Molecular Weight | 204.179 |
| Structure |  |
| SMILES | OC(=O)c1cccc2c1c(O)c(cc2)O |
| Reactions | OSR0270 |
| Pathways | |
|---|---|
| KEGG | rn00626 rn01120 |
| Database Links | |
|---|---|
| KEGG | C14093 |
| Pubchem Compound | 656873 |
| Pubchem Substance | 854329 |