RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0665 |
| Common Name | 6-Deoxy-L-galactose |
| Synonyms Names | L-Fucose |
| Formula | C6H12O5 |
| Formula at pH 7.2 (Predicted) | C6H12O5 |
| Molecular Weight | 164.156 |
| Structure |  |
| SMILES | C1(C(O)C(O)C(O)C(C)O1)(O) |
| Reactions | OSR0240 OSR1179 OSR1380 |
| Pathways | |
|---|---|
| KEGG | rn00051 rn00520 rn01100 |
| Metacyc | FUCCAT-PWY |
| Database Links | |
|---|---|
| KEGG | C01019 |
| ChEBI | 2181 |