RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0676 |
| Common Name | 5-Hydroxyindoleacetate |
| Formula | C10H9NO3 |
| Formula at pH 7.2 (Predicted) | C10H8NO3- |
| Molecular Weight | 191.183 |
| Structure |  |
| SMILES | OC(=O)Cc1cc2c([nH]1)ccc(c2)O |
| Reactions | OSR1815 |
| Pathways | |
|---|---|
| KEGG | rn00380 rn01100 |
| Database Links | |
|---|---|
| KEGG | C05635 |
| ChEBI | 27823 |
| Pubchem Compound | 15919788 |
| Pubchem Substance | 7946 |