RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0685 |
| Common Name | Beta-D-Glucuronides |
| Formula | C6H9O7R |
| Formula at pH 7.2 (Predicted) | C6H8O7R- |
| Structure |  |
| SMILES | O=C(O)C1(OC(O[R])C(O)C(O)C(O)1) |
| Reactions | OSR0405 |
| Pathways | |
|---|---|
| Metacyc | GLUCUROCAT-PWY |