RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0688 |
| Common Name | 2-Amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine |
| Synonyms Names | 6-hydroxymethyl-dihydropterin |
| Formula | C7H9N5O2 |
| Formula at pH 7.2 (Predicted) | C7H9N5O2 |
| Molecular Weight | 195.179 |
| Structure |  |
| SMILES | NC1=NC2=C(N=C(CO)CN2)C(=N1)O |
| Reactions | OSR0445 OSR0628 OSR1184 |
| Pathways | |
|---|---|
| KEGG | rn00790 rn01100 |
| Metacyc | FOLSYN-PWY PWY-3742 |
| Database Links | |
|---|---|
| KEGG | C01300 |
| ChEBI | 17083 |
| Pubchem Compound | 218 |
| Pubchem Substance | 4518 |