RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0695 |
| Common Name | O-Phospho-4-hydroxy-L-threonine |
| Synonyms Names | 4-(Phosphonooxy)-threonine ;4-(Phosphonooxy)-L-threonine |
| Formula | C4H10NO7P |
| Formula at pH 7.2 (Predicted) | C4H8NO7P2- |
| Molecular Weight | 215.099 |
| Structure |  |
| SMILES | C(=O)([O-1])C(N)C(O)COP(=O)(O)O |
| Reactions | OSR0324 OSR0580 OSR1741 |
| Pathways | |
|---|---|
| KEGG | rn00750 |
| Database Links | |
|---|---|
| KEGG | C06055 |
| ChEBI | 18336 |