RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0696 |
| Common Name | Phospholipid |
| Synonyms Names | C00865 |
| Formula | C5H6O8PR3 |
| Formula at pH 7.2 (Predicted) | C5H5O8PR32- |
| Structure |  |
| SMILES | O([P](O)(=O)OCC(COC(=O)[R])OC(=O)[R])[R] |
| Reactions | OSR0407 OSR0653 |
| Pathways | |
|---|---|
| KEGG | rn00565 rn00564 rn01100 rn00561 |
| Metacyc | PWY-3561 LIPASYN-PWY |
| Database Links | |
|---|---|
| KEGG | C00865 |
| Pubchem Substance | 4122 |