RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC0707 |
| Common Name | 5-Hydroxyconiferaldehyde |
| Formula | C10H10O4 |
| Formula at pH 7.2 (Predicted) | C10H10O4 |
| Molecular Weight | 194.184 |
| Structure |  |
| SMILES | C(=O)C=Cc1(cc(OC)c(O)c(c1)O) |
| Reactions | OSR1243 OSR1952 OSR1984 OSR2896 |
| Pathways | |
|---|---|
| KEGG | rn00940 rn01110 rn01100 |
| Database Links | |
|---|---|
| KEGG | C12204 |
| Pubchem Compound | 5282094 |
| Pubchem Substance | 14350 |